C11H14Cl3N3 — CID 102751027
N'-cyclopropyl-N'-methyl-N-(3,5,6-trichloro-2-pyridinyl)ethane-1,2-diamine (PubChem CID 102751027) has the molecular formula C11H14Cl3N3 and a molecular weight of 294.61 g/mol. Its IUPAC name is N'-cyclopropyl-N'-methyl-N-(3,5,6-trichloro-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N'-methyl-N-(3,5,6-trichloro-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 102751027 |
| Molecular Formula | C11H14Cl3N3 |
| Molecular Weight | 294.61 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | N'-cyclopropyl-N'-methyl-N-(3,5,6-trichloro-2-pyridinyl)ethane-1,2-diamine |
| SMILES | CN(CCNc1nc(Cl)c(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C11H14Cl3N3/c1-17(7-2-3-7)5-4-15-11-9(13)6-8(12)10(14)16-11/h6-7H,2-5H2,1H3,(H,15,16) |
| InChIKey | MZDPCVGTMBKXFK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|