C7H12ClN5O — CID 80779012
2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]butan-1-ol (PubChem CID 80779012) has the molecular formula C7H12ClN5O and a molecular weight of 217.66 g/mol. Its IUPAC name is 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]butan-1-ol.
| Compound Name | 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 80779012 |
| Molecular Formula | C7H12ClN5O |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]butan-1-ol |
| SMILES | CCC(CO)Nc1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C7H12ClN5O/c1-2-4(3-14)10-7-12-5(8)11-6(9)13-7/h4,14H,2-3H2,1H3,(H3,9,10,11,12,13) |
| InChIKey | LJKKVIIADBNOKO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |