C12H18N4O2 — CID 55136076
N-(dicyclopropylmethyl)-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 55136076) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(dicyclopropylmethyl)-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 55136076 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N-(dicyclopropylmethyl)-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NC(C2CC2)C2CC2)nc(OC)n1 |
| InChI | InChI=1S/C12H18N4O2/c1-17-11-14-10(15-12(16-11)18-2)13-9(7-3-4-7)8-5-6-8/h7-9H,3-6H2,1-2H3,(H,13,14,15,16) |
| InChIKey | GSHLZMXBJAELJC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |