C19H21F2N3O2 — CID 118778594
2-(2,4-difluorophenoxy)-N-[1-(pyridin-3-ylmethyl)piperidin-3-yl]acetamide (PubChem CID 118778594) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-N-[1-(pyridin-3-ylmethyl)piperidin-3-yl]acetamide.
| Compound Name | 2-(2,4-difluorophenoxy)-N-[1-(pyridin-3-ylmethyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 118778594 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-N-[1-(pyridin-3-ylmethyl)piperidin-3-yl]acetamide |
| SMILES | O=C(COc1ccc(F)cc1F)NC1CCCN(Cc2cccnc2)C1 |
| InChI | InChI=1S/C19H21F2N3O2/c20-15-5-6-18(17(21)9-15)26-13-19(25)23-16-4-2-8-24(12-16)11-14-3-1-7-22-10-14/h1,3,5-7,9-10,16H,2,4,8,11-13H2,(H,23,25) |
| InChIKey | HKZMBHQNLJJXJU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |