C16H21F4N3O2 — CID 125155616
N-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 125155616) has the molecular formula C16H21F4N3O2 and a molecular weight of 363.36 g/mol. Its IUPAC name is N-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 125155616 |
| Molecular Formula | C16H21F4N3O2 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | O=C(COCC(F)(F)C(F)F)N[C@@H]1CCCN(Cc2cccnc2)C1 |
| InChI | InChI=1S/C16H21F4N3O2/c17-15(18)16(19,20)11-25-10-14(24)22-13-4-2-6-23(9-13)8-12-3-1-5-21-7-12/h1,3,5,7,13,15H,2,4,6,8-11H2,(H,22,24)/t13-/m1/s1 |
| InChIKey | GFSNCHMGKWLOHE-CYBMUJFWSA-N |
| XLogP | 2.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|