C16H19F2N5O — CID 125173875
1-(difluoromethyl)-N-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]pyrazole-3-carboxamide (PubChem CID 125173875) has the molecular formula C16H19F2N5O and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-(difluoromethyl)-N-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]pyrazole-3-carboxamide.
| Compound Name | 1-(difluoromethyl)-N-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 125173875 |
| Molecular Formula | C16H19F2N5O |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-(difluoromethyl)-N-[(3R)-1-(pyridin-3-ylmethyl)piperidin-3-yl]pyrazole-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCN(Cc2cccnc2)C1)c1ccn(C(F)F)n1 |
| InChI | InChI=1S/C16H19F2N5O/c17-16(18)23-8-5-14(21-23)15(24)20-13-4-2-7-22(11-13)10-12-3-1-6-19-9-12/h1,3,5-6,8-9,13,16H,2,4,7,10-11H2,(H,20,24)/t13-/m1/s1 |
| InChIKey | CILZZFYLJSYGSK-CYBMUJFWSA-N |
| XLogP | 2.07 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |