C21H22FN3 — CID 95870220
N-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]quinolin-2-amine (PubChem CID 95870220) has the molecular formula C21H22FN3 and a molecular weight of 335.43 g/mol. Its IUPAC name is N-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]quinolin-2-amine.
| Compound Name | N-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]quinolin-2-amine |
|---|---|
| PubChem CID | 95870220 |
| Molecular Formula | C21H22FN3 |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]quinolin-2-amine |
| SMILES | Fc1ccccc1CN1CCC[C@@H](Nc2ccc3ccccc3n2)C1 |
| InChI | InChI=1S/C21H22FN3/c22-19-9-3-1-7-17(19)14-25-13-5-8-18(15-25)23-21-12-11-16-6-2-4-10-20(16)24-21/h1-4,6-7,9-12,18H,5,8,13-15H2,(H,23,24)/t18-/m1/s1 |
| InChIKey | GBCSMMWBZLLRPL-GOSISDBHSA-N |
| XLogP | 4.45 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |