C16H19FN4O — CID 171995465
N-[1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]-6-methoxypyrimidin-4-amine (PubChem CID 171995465) has the molecular formula C16H19FN4O and a molecular weight of 302.35 g/mol. Its IUPAC name is N-[1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]-6-methoxypyrimidin-4-amine.
| Compound Name | N-[1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]-6-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 171995465 |
| Molecular Formula | C16H19FN4O |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-[1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]-6-methoxypyrimidin-4-amine |
| SMILES | COc1cc(NC2CCN(Cc3ccccc3F)C2)ncn1 |
| InChI | InChI=1S/C16H19FN4O/c1-22-16-8-15(18-11-19-16)20-13-6-7-21(10-13)9-12-4-2-3-5-14(12)17/h2-5,8,11,13H,6-7,9-10H2,1H3,(H,18,19,20) |
| InChIKey | GILKRPMQDREUIZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |