C18H25FN4 — CID 28954232
(3S)-1-[(2-fluorophenyl)methyl]-N-(3-pyrazol-1-ylpropyl)piperidin-3-amine (PubChem CID 28954232) has the molecular formula C18H25FN4 and a molecular weight of 316.42 g/mol. Its IUPAC name is (3S)-1-[(2-fluorophenyl)methyl]-N-(3-pyrazol-1-ylpropyl)piperidin-3-amine.
| Compound Name | (3S)-1-[(2-fluorophenyl)methyl]-N-(3-pyrazol-1-ylpropyl)piperidin-3-amine |
|---|---|
| PubChem CID | 28954232 |
| Molecular Formula | C18H25FN4 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (3S)-1-[(2-fluorophenyl)methyl]-N-(3-pyrazol-1-ylpropyl)piperidin-3-amine |
| SMILES | Fc1ccccc1CN1CCC[C@H](NCCCn2cccn2)C1 |
| InChI | InChI=1S/C18H25FN4/c19-18-8-2-1-6-16(18)14-22-11-3-7-17(15-22)20-9-4-12-23-13-5-10-21-23/h1-2,5-6,8,10,13,17,20H,3-4,7,9,11-12,14-15H2/t17-/m0/s1 |
| InChIKey | VMFKXCABEUUQKM-KRWDZBQOSA-N |
| XLogP | 2.67 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|