C14H26N4 — CID 113412467
1-ethyl-N-(3-pyrazol-1-ylpropyl)azepan-4-amine (PubChem CID 113412467) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is 1-ethyl-N-(3-pyrazol-1-ylpropyl)azepan-4-amine.
| Compound Name | 1-ethyl-N-(3-pyrazol-1-ylpropyl)azepan-4-amine |
|---|---|
| PubChem CID | 113412467 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 1-ethyl-N-(3-pyrazol-1-ylpropyl)azepan-4-amine |
| SMILES | CCN1CCCC(NCCCn2cccn2)CC1 |
| InChI | InChI=1S/C14H26N4/c1-2-17-10-3-6-14(7-13-17)15-8-4-11-18-12-5-9-16-18/h5,9,12,14-15H,2-4,6-8,10-11,13H2,1H3 |
| InChIKey | RFNONDLMYPLWJU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|