C13H20N4 — CID 99777730
cis-(1R,3S)-3-(3-pyrazol-1-ylpropylamino)cyclohexane-1-carbonitrile (PubChem CID 99777730) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is cis-(1R,3S)-3-(3-pyrazol-1-ylpropylamino)cyclohexane-1-carbonitrile.
| Compound Name | cis-(1R,3S)-3-(3-pyrazol-1-ylpropylamino)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 99777730 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | cis-(1R,3S)-3-(3-pyrazol-1-ylpropylamino)cyclohexane-1-carbonitrile |
| SMILES | N#C[C@@H]1CCC[C@H](NCCCn2cccn2)C1 |
| InChI | InChI=1S/C13H20N4/c14-11-12-4-1-5-13(10-12)15-6-2-8-17-9-3-7-16-17/h3,7,9,12-13,15H,1-2,4-6,8,10H2/t12-,13+/m1/s1 |
| InChIKey | LQCWUNMDNCWZAU-OLZOCXBDSA-N |
| XLogP | 1.95 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|