C12H21N3O2S — CID 99638037
trans-(1R,2R)-2-methylsulfonyl-N-(3-pyrazol-1-ylpropyl)cyclopentan-1-amine (PubChem CID 99638037) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is trans-(1R,2R)-2-methylsulfonyl-N-(3-pyrazol-1-ylpropyl)cyclopentan-1-amine.
| Compound Name | trans-(1R,2R)-2-methylsulfonyl-N-(3-pyrazol-1-ylpropyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 99638037 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | trans-(1R,2R)-2-methylsulfonyl-N-(3-pyrazol-1-ylpropyl)cyclopentan-1-amine |
| SMILES | CS(=O)(=O)[C@@H]1CCC[C@H]1NCCCn1cccn1 |
| InChI | InChI=1S/C12H21N3O2S/c1-18(16,17)12-6-2-5-11(12)13-7-3-9-15-10-4-8-14-15/h4,8,10-13H,2-3,5-7,9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | QWKWVGCYPFPUQS-VXGBXAGGSA-N |
| XLogP | 0.83 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|