C12H18F3N3 — CID 64759430
N-(2-pyrazol-1-ylethyl)-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 64759430) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is N-(2-pyrazol-1-ylethyl)-3-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-(2-pyrazol-1-ylethyl)-3-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64759430 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-(2-pyrazol-1-ylethyl)-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | FC(F)(F)C1CCCC(NCCn2cccn2)C1 |
| InChI | InChI=1S/C12H18F3N3/c13-12(14,15)10-3-1-4-11(9-10)16-6-8-18-7-2-5-17-18/h2,5,7,10-11,16H,1,3-4,6,8-9H2 |
| InChIKey | PFNUIFGFBSUJCB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |