C24H30N2O9 — CID 17384983
(3,5-dimethoxyphenyl)-[4-[(2,4-dimethoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid (PubChem CID 17384983) has the molecular formula C24H30N2O9 and a molecular weight of 490.51 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-[4-[(2,4-dimethoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid.
| Compound Name | (3,5-dimethoxyphenyl)-[4-[(2,4-dimethoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 17384983 |
| Molecular Formula | C24H30N2O9 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (3,5-dimethoxyphenyl)-[4-[(2,4-dimethoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(Cc3ccc(OC)cc3OC)CC2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H28N2O5.C2H2O4/c1-26-18-6-5-16(21(14-18)29-4)15-23-7-9-24(10-8-23)22(25)17-11-19(27-2)13-20(12-17)28-3;3-1(4)2(5)6/h5-6,11-14H,7-10,15H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | NXHQEMXWIZCUEE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|