C15H19ClN4O2 — CID 170951885
1-[2-chloro-5-(4-methylpiperazin-1-yl)phenyl]-1,3-diazinane-2,4-dione (PubChem CID 170951885) has the molecular formula C15H19ClN4O2 and a molecular weight of 322.80 g/mol. Its IUPAC name is 1-[2-chloro-5-(4-methylpiperazin-1-yl)phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-chloro-5-(4-methylpiperazin-1-yl)phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 170951885 |
| Molecular Formula | C15H19ClN4O2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-[2-chloro-5-(4-methylpiperazin-1-yl)phenyl]-1,3-diazinane-2,4-dione |
| SMILES | CN1CCN(c2ccc(Cl)c(N3CCC(=O)NC3=O)c2)CC1 |
| InChI | InChI=1S/C15H19ClN4O2/c1-18-6-8-19(9-7-18)11-2-3-12(16)13(10-11)20-5-4-14(21)17-15(20)22/h2-3,10H,4-9H2,1H3,(H,17,21,22) |
| InChIKey | HYOXXOOTQJHDRJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |