C25H36N4O6 — CID 164851300
tert-butyl 5-[4-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]piperazin-1-yl]pentanoate (PubChem CID 164851300) has the molecular formula C25H36N4O6 and a molecular weight of 488.59 g/mol. Its IUPAC name is tert-butyl 5-[4-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]piperazin-1-yl]pentanoate.
| Compound Name | tert-butyl 5-[4-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]piperazin-1-yl]pentanoate |
|---|---|
| PubChem CID | 164851300 |
| Molecular Formula | C25H36N4O6 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | tert-butyl 5-[4-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]piperazin-1-yl]pentanoate |
| SMILES | COc1ccc(C(=O)N2CCN(CCCCC(=O)OC(C)(C)C)CC2)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C25H36N4O6/c1-25(2,3)35-22(31)7-5-6-11-27-13-15-28(16-14-27)23(32)18-8-9-20(34-4)19(17-18)29-12-10-21(30)26-24(29)33/h8-9,17H,5-7,10-16H2,1-4H3,(H,26,30,33) |
| InChIKey | WYCZLEHVNAZOTD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|