C25H34N4O5 — CID 162721674
4-[3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]-3,9-diazaspiro[5.5]undecan-9-yl]butanal (PubChem CID 162721674) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-[3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]-3,9-diazaspiro[5.5]undecan-9-yl]butanal.
| Compound Name | 4-[3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]-3,9-diazaspiro[5.5]undecan-9-yl]butanal |
|---|---|
| PubChem CID | 162721674 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 4-[3-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]-3,9-diazaspiro[5.5]undecan-9-yl]butanal |
| SMILES | COc1ccc(C(=O)N2CCC3(CCN(CCCC=O)CC3)CC2)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C25H34N4O5/c1-34-21-5-4-19(18-20(21)29-12-6-22(31)26-24(29)33)23(32)28-15-9-25(10-16-28)7-13-27(14-8-25)11-2-3-17-30/h4-5,17-18H,2-3,6-16H2,1H3,(H,26,31,33) |
| InChIKey | KWPCUDDABRTTJQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|