C26H38N4O6 — CID 164851150
tert-butyl 6-[4-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]piperazin-1-yl]hexanoate (PubChem CID 164851150) has the molecular formula C26H38N4O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is tert-butyl 6-[4-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]piperazin-1-yl]hexanoate.
| Compound Name | tert-butyl 6-[4-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]piperazin-1-yl]hexanoate |
|---|---|
| PubChem CID | 164851150 |
| Molecular Formula | C26H38N4O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | tert-butyl 6-[4-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]piperazin-1-yl]hexanoate |
| SMILES | COc1ccc(C(=O)N2CCN(CCCCCC(=O)OC(C)(C)C)CC2)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C26H38N4O6/c1-26(2,3)36-23(32)8-6-5-7-12-28-14-16-29(17-15-28)24(33)19-9-10-21(35-4)20(18-19)30-13-11-22(31)27-25(30)34/h9-10,18H,5-8,11-17H2,1-4H3,(H,27,31,34) |
| InChIKey | DQBMZVFNMNKJOL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|