C30H39N5O10S2 — CID 171647558
tert-butyl 3-[2-[2-[2-[[3,5-bis(2-methylsulfonylpyrimidin-5-yl)benzoyl]amino]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 171647558) has the molecular formula C30H39N5O10S2 and a molecular weight of 693.80 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-[[3,5-bis(2-methylsulfonylpyrimidin-5-yl)benzoyl]amino]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[2-[[3,5-bis(2-methylsulfonylpyrimidin-5-yl)benzoyl]amino]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 171647558 |
| Molecular Formula | C30H39N5O10S2 |
| Molecular Weight | 693.80 g/mol |
| Exact Mass | 693.21 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-[[3,5-bis(2-methylsulfonylpyrimidin-5-yl)benzoyl]amino]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCNC(=O)c1cc(-c2cnc(S(C)(=O)=O)nc2)cc(-c2cnc(S(C)(=O)=O)nc2)c1 |
| InChI | InChI=1S/C30H39N5O10S2/c1-30(2,3)45-26(36)6-8-42-10-12-44-13-11-43-9-7-31-27(37)23-15-21(24-17-32-28(33-18-24)46(4,38)39)14-22(16-23)25-19-34-29(35-20-25)47(5,40)41/h14-20H,6-13H2,1-5H3,(H,31,37) |
| InChIKey | ITPQSKUZDJOSIT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 202.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.80 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|