C13H18N2O2S — CID 81091777
3-amino-5-methoxy-N-(thiolan-2-ylmethyl)benzamide (PubChem CID 81091777) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 3-amino-5-methoxy-N-(thiolan-2-ylmethyl)benzamide.
| Compound Name | 3-amino-5-methoxy-N-(thiolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 81091777 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-amino-5-methoxy-N-(thiolan-2-ylmethyl)benzamide |
| SMILES | COc1cc(N)cc(C(=O)NCC2CCCS2)c1 |
| InChI | InChI=1S/C13H18N2O2S/c1-17-11-6-9(5-10(14)7-11)13(16)15-8-12-3-2-4-18-12/h5-7,12H,2-4,8,14H2,1H3,(H,15,16) |
| InChIKey | NURRECCEOJGFFV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|