C14H16N2O5S — CID 166216897
methyl 3-nitro-5-(thiolan-2-ylmethylcarbamoyl)benzoate (PubChem CID 166216897) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is methyl 3-nitro-5-(thiolan-2-ylmethylcarbamoyl)benzoate.
| Compound Name | methyl 3-nitro-5-(thiolan-2-ylmethylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 166216897 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | methyl 3-nitro-5-(thiolan-2-ylmethylcarbamoyl)benzoate |
| SMILES | COC(=O)c1cc(C(=O)NCC2CCCS2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16N2O5S/c1-21-14(18)10-5-9(6-11(7-10)16(19)20)13(17)15-8-12-3-2-4-22-12/h5-7,12H,2-4,8H2,1H3,(H,15,17) |
| InChIKey | HNWUVIUTCGJJSL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|