C12H11N3O4S — CID 106407636
(E)-3-[2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 106407636) has the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. Its IUPAC name is (E)-3-[2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106407636 |
| Molecular Formula | C12H11N3O4S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (E)-3-[2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccsc1C(=O)NCCc1ncno1 |
| InChI | InChI=1S/C12H11N3O4S/c16-10(17)2-1-8-4-6-20-11(8)12(18)13-5-3-9-14-7-15-19-9/h1-2,4,6-7H,3,5H2,(H,13,18)(H,16,17)/b2-1+ |
| InChIKey | HRGUKVJCGGKHOT-OWOJBTEDSA-N |
| XLogP | 1.20 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|