C11H10BrF4NO — CID 79039788
2-bromo-4-fluoro-N-(4,4,4-trifluorobutyl)benzamide (PubChem CID 79039788) has the molecular formula C11H10BrF4NO and a molecular weight of 328.10 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-(4,4,4-trifluorobutyl)benzamide.
| Compound Name | 2-bromo-4-fluoro-N-(4,4,4-trifluorobutyl)benzamide |
|---|---|
| PubChem CID | 79039788 |
| Molecular Formula | C11H10BrF4NO |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 2-bromo-4-fluoro-N-(4,4,4-trifluorobutyl)benzamide |
| SMILES | O=C(NCCCC(F)(F)F)c1ccc(F)cc1Br |
| InChI | InChI=1S/C11H10BrF4NO/c12-9-6-7(13)2-3-8(9)10(18)17-5-1-4-11(14,15)16/h2-3,6H,1,4-5H2,(H,17,18) |
| InChIKey | DZUQWGLJDBVHFN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|