C12H15BrFN3O2 — CID 77036778
N-(5-amino-5-hydroxyiminopentyl)-2-bromo-4-fluorobenzamide (PubChem CID 77036778) has the molecular formula C12H15BrFN3O2 and a molecular weight of 332.17 g/mol. Its IUPAC name is N-(5-amino-5-hydroxyiminopentyl)-2-bromo-4-fluorobenzamide.
| Compound Name | N-(5-amino-5-hydroxyiminopentyl)-2-bromo-4-fluorobenzamide |
|---|---|
| PubChem CID | 77036778 |
| Molecular Formula | C12H15BrFN3O2 |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | N-(5-amino-5-hydroxyiminopentyl)-2-bromo-4-fluorobenzamide |
| SMILES | NC(CCCCNC(=O)c1ccc(F)cc1Br)=NO |
| InChI | InChI=1S/C12H15BrFN3O2/c13-10-7-8(14)4-5-9(10)12(18)16-6-2-1-3-11(15)17-19/h4-5,7,19H,1-3,6H2,(H2,15,17)(H,16,18) |
| InChIKey | ARXSARKUCYNKAG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|