C11H16BrNOS2 — CID 4985303
3-bromo-N-(2-tert-butylsulfanylethyl)thiophene-2-carboxamide (PubChem CID 4985303) has the molecular formula C11H16BrNOS2 and a molecular weight of 322.29 g/mol. Its IUPAC name is 3-bromo-N-(2-tert-butylsulfanylethyl)thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-(2-tert-butylsulfanylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4985303 |
| Molecular Formula | C11H16BrNOS2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 3-bromo-N-(2-tert-butylsulfanylethyl)thiophene-2-carboxamide |
| SMILES | CC(C)(C)SCCNC(=O)c1sccc1Br |
| InChI | InChI=1S/C11H16BrNOS2/c1-11(2,3)16-7-5-13-10(14)9-8(12)4-6-15-9/h4,6H,5,7H2,1-3H3,(H,13,14) |
| InChIKey | KXLQPSXYHPHZJR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|