C11H16BrNOS — CID 64596699
3-bromo-N-(2,3-dimethylbutyl)thiophene-2-carboxamide (PubChem CID 64596699) has the molecular formula C11H16BrNOS and a molecular weight of 290.23 g/mol. Its IUPAC name is 3-bromo-N-(2,3-dimethylbutyl)thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-(2,3-dimethylbutyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 64596699 |
| Molecular Formula | C11H16BrNOS |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 3-bromo-N-(2,3-dimethylbutyl)thiophene-2-carboxamide |
| SMILES | CC(C)C(C)CNC(=O)c1sccc1Br |
| InChI | InChI=1S/C11H16BrNOS/c1-7(2)8(3)6-13-11(14)10-9(12)4-5-15-10/h4-5,7-8H,6H2,1-3H3,(H,13,14) |
| InChIKey | JABOQUYLNAYUHQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |