C11H8BrClN2O3S2 — CID 107517313
5-[[(3-bromopyridine-2-carbonyl)amino]methyl]thiophene-2-sulfonyl chloride (PubChem CID 107517313) has the molecular formula C11H8BrClN2O3S2 and a molecular weight of 395.69 g/mol. Its IUPAC name is 5-[[(3-bromopyridine-2-carbonyl)amino]methyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[[(3-bromopyridine-2-carbonyl)amino]methyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 107517313 |
| Molecular Formula | C11H8BrClN2O3S2 |
| Molecular Weight | 395.69 g/mol |
| Exact Mass | 393.88 |
| IUPAC Name | 5-[[(3-bromopyridine-2-carbonyl)amino]methyl]thiophene-2-sulfonyl chloride |
| SMILES | O=C(NCc1ccc(S(=O)(=O)Cl)s1)c1ncccc1Br |
| InChI | InChI=1S/C11H8BrClN2O3S2/c12-8-2-1-5-14-10(8)11(16)15-6-7-3-4-9(19-7)20(13,17)18/h1-5H,6H2,(H,15,16) |
| InChIKey | NONKCRUUCJUWSF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.69 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |