C12H8BrClFNO3S2 — CID 43362991
5-[[(2-bromo-5-fluorobenzoyl)amino]methyl]thiophene-2-sulfonyl chloride (PubChem CID 43362991) has the molecular formula C12H8BrClFNO3S2 and a molecular weight of 412.69 g/mol. Its IUPAC name is 5-[[(2-bromo-5-fluorobenzoyl)amino]methyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[[(2-bromo-5-fluorobenzoyl)amino]methyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 43362991 |
| Molecular Formula | C12H8BrClFNO3S2 |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 410.88 |
| IUPAC Name | 5-[[(2-bromo-5-fluorobenzoyl)amino]methyl]thiophene-2-sulfonyl chloride |
| SMILES | O=C(NCc1ccc(S(=O)(=O)Cl)s1)c1cc(F)ccc1Br |
| InChI | InChI=1S/C12H8BrClFNO3S2/c13-10-3-1-7(15)5-9(10)12(17)16-6-8-2-4-11(20-8)21(14,18)19/h1-5H,6H2,(H,16,17) |
| InChIKey | AEQCNAAILOLIPJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |