C11H9ClN2O3S2 — CID 43173405
5-[(pyridine-3-carbonylamino)methyl]thiophene-2-sulfonyl chloride (PubChem CID 43173405) has the molecular formula C11H9ClN2O3S2 and a molecular weight of 316.79 g/mol. Its IUPAC name is 5-[(pyridine-3-carbonylamino)methyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[(pyridine-3-carbonylamino)methyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 43173405 |
| Molecular Formula | C11H9ClN2O3S2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 5-[(pyridine-3-carbonylamino)methyl]thiophene-2-sulfonyl chloride |
| SMILES | O=C(NCc1ccc(S(=O)(=O)Cl)s1)c1cccnc1 |
| InChI | InChI=1S/C11H9ClN2O3S2/c12-19(16,17)10-4-3-9(18-10)7-14-11(15)8-2-1-5-13-6-8/h1-6H,7H2,(H,14,15) |
| InChIKey | YQBDGOXNFXWSLN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |