C11H16N2O4S2 — CID 81425841
3-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]oxolane-2-carboxamide (PubChem CID 81425841) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]oxolane-2-carboxamide.
| Compound Name | 3-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 81425841 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]oxolane-2-carboxamide |
| SMILES | CC1CCOC1C(=O)NCc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C11H16N2O4S2/c1-7-4-5-17-10(7)11(14)13-6-8-2-3-9(18-8)19(12,15)16/h2-3,7,10H,4-6H2,1H3,(H,13,14)(H2,12,15,16) |
| InChIKey | FQJQSNZMQRSNOP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |