C9H14ClNO2 — CID 115734116
N-(2-chloroprop-2-enyl)-3-methyloxolane-2-carboxamide (PubChem CID 115734116) has the molecular formula C9H14ClNO2 and a molecular weight of 203.67 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-3-methyloxolane-2-carboxamide.
| Compound Name | N-(2-chloroprop-2-enyl)-3-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 115734116 |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-3-methyloxolane-2-carboxamide |
| SMILES | C=C(Cl)CNC(=O)C1OCCC1C |
| InChI | InChI=1S/C9H14ClNO2/c1-6-3-4-13-8(6)9(12)11-5-7(2)10/h6,8H,2-5H2,1H3,(H,11,12) |
| InChIKey | NSECMLQOJOWPOH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |