C20H19N3O3S3 — CID 55339921
3-phenothiazin-10-yl-N-[(5-sulfamoylthiophen-2-yl)methyl]propanamide (PubChem CID 55339921) has the molecular formula C20H19N3O3S3 and a molecular weight of 445.59 g/mol. Its IUPAC name is 3-phenothiazin-10-yl-N-[(5-sulfamoylthiophen-2-yl)methyl]propanamide.
| Compound Name | 3-phenothiazin-10-yl-N-[(5-sulfamoylthiophen-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 55339921 |
| Molecular Formula | C20H19N3O3S3 |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 3-phenothiazin-10-yl-N-[(5-sulfamoylthiophen-2-yl)methyl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)CCN2c3ccccc3Sc3ccccc32)s1 |
| InChI | InChI=1S/C20H19N3O3S3/c21-29(25,26)20-10-9-14(27-20)13-22-19(24)11-12-23-15-5-1-3-7-17(15)28-18-8-4-2-6-16(18)23/h1-10H,11-13H2,(H,22,24)(H2,21,25,26) |
| InChIKey | NGBOLDUVQMDRGZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|