C20H25N3OS — CID 120655173
N-[(2R)-2-(ethylamino)propyl]-3-phenothiazin-10-ylpropanamide (PubChem CID 120655173) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-3-phenothiazin-10-ylpropanamide.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-3-phenothiazin-10-ylpropanamide |
|---|---|
| PubChem CID | 120655173 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-3-phenothiazin-10-ylpropanamide |
| SMILES | CCN[C@H](C)CNC(=O)CCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C20H25N3OS/c1-3-21-15(2)14-22-20(24)12-13-23-16-8-4-6-10-18(16)25-19-11-7-5-9-17(19)23/h4-11,15,21H,3,12-14H2,1-2H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | JXYNTNSCDMQKCF-OAHLLOKOSA-N |
| XLogP | 3.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|