C21H23N3O4S — CID 42970448
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-phenothiazin-10-ylpropanoate (PubChem CID 42970448) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-phenothiazin-10-ylpropanoate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-phenothiazin-10-ylpropanoate |
|---|---|
| PubChem CID | 42970448 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-phenothiazin-10-ylpropanoate |
| SMILES | CCNC(=O)NC(=O)C(C)OC(=O)CCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C21H23N3O4S/c1-3-22-21(27)23-20(26)14(2)28-19(25)12-13-24-15-8-4-6-10-17(15)29-18-11-7-5-9-16(18)24/h4-11,14H,3,12-13H2,1-2H3,(H2,22,23,26,27) |
| InChIKey | VSQXHLOGMUCFLF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|