C31H26N2O5S — CID 2102776
[(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 3-phenothiazin-10-ylpropanoate (PubChem CID 2102776) has the molecular formula C31H26N2O5S and a molecular weight of 538.63 g/mol. Its IUPAC name is [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 3-phenothiazin-10-ylpropanoate.
| Compound Name | [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 3-phenothiazin-10-ylpropanoate |
|---|---|
| PubChem CID | 2102776 |
| Molecular Formula | C31H26N2O5S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | [(2R)-1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 3-phenothiazin-10-ylpropanoate |
| SMILES | COc1cc2c(cc1NC(=O)[C@@H](C)OC(=O)CCN1c3ccccc3Sc3ccccc31)oc1ccccc12 |
| InChI | InChI=1S/C31H26N2O5S/c1-19(31(35)32-22-18-26-21(17-27(22)36-2)20-9-3-6-12-25(20)38-26)37-30(34)15-16-33-23-10-4-7-13-28(23)39-29-14-8-5-11-24(29)33/h3-14,17-19H,15-16H2,1-2H3,(H,32,35)/t19-/m1/s1 |
| InChIKey | GJRCFEPSNGTUFJ-LJQANCHMSA-N |
| XLogP | 7.16 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|