C23H26N2O3S — CID 4843139
[1-(cyclopentylamino)-1-oxopropan-2-yl] 3-phenothiazin-10-ylpropanoate (PubChem CID 4843139) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is [1-(cyclopentylamino)-1-oxopropan-2-yl] 3-phenothiazin-10-ylpropanoate.
| Compound Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 3-phenothiazin-10-ylpropanoate |
|---|---|
| PubChem CID | 4843139 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 3-phenothiazin-10-ylpropanoate |
| SMILES | CC(OC(=O)CCN1c2ccccc2Sc2ccccc21)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C23H26N2O3S/c1-16(23(27)24-17-8-2-3-9-17)28-22(26)14-15-25-18-10-4-6-12-20(18)29-21-13-7-5-11-19(21)25/h4-7,10-13,16-17H,2-3,8-9,14-15H2,1H3,(H,24,27) |
| InChIKey | SGKXUAHPKRNCPE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|