C16H19ClN2O5 — CID 2521344
[(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 2521344) has the molecular formula C16H19ClN2O5 and a molecular weight of 354.79 g/mol. Its IUPAC name is [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 2521344 |
| Molecular Formula | C16H19ClN2O5 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | CCNC(=O)NC(=O)[C@@H](C)OC(=O)CCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClN2O5/c1-3-18-16(23)19-15(22)10(2)24-14(21)9-8-13(20)11-4-6-12(17)7-5-11/h4-7,10H,3,8-9H2,1-2H3,(H2,18,19,22,23)/t10-/m1/s1 |
| InChIKey | ARTWTIMXOKLJCO-SNVBAGLBSA-N |
| XLogP | 2.08 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |