C16H21N3O5 — CID 95788326
[(2S)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(4-aminophenyl)-4-oxobutanoate (PubChem CID 95788326) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is [(2S)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(4-aminophenyl)-4-oxobutanoate.
| Compound Name | [(2S)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(4-aminophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 95788326 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [(2S)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(4-aminophenyl)-4-oxobutanoate |
| SMILES | CCNC(=O)NC(=O)[C@H](C)OC(=O)CCC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H21N3O5/c1-3-18-16(23)19-15(22)10(2)24-14(21)9-8-13(20)11-4-6-12(17)7-5-11/h4-7,10H,3,8-9,17H2,1-2H3,(H2,18,19,22,23)/t10-/m0/s1 |
| InChIKey | CQTLGBDJKPNMIY-JTQLQIEISA-N |
| XLogP | 1.01 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|