C15H17ClN2O5 — CID 7750869
[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 7750869) has the molecular formula C15H17ClN2O5 and a molecular weight of 340.76 g/mol. Its IUPAC name is [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7750869 |
| Molecular Formula | C15H17ClN2O5 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | CNC(=O)NC(=O)[C@H](C)OC(=O)CCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClN2O5/c1-9(14(21)18-15(22)17-2)23-13(20)8-7-12(19)10-3-5-11(16)6-4-10/h3-6,9H,7-8H2,1-2H3,(H2,17,18,21,22)/t9-/m0/s1 |
| InChIKey | UUQZGXZAXWZREA-VIFPVBQESA-N |
| XLogP | 1.69 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |