C20H23N3O3S2 — CID 24625349
N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-3-pyrrol-1-ylthiophene-2-carboxamide (PubChem CID 24625349) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-3-pyrrol-1-ylthiophene-2-carboxamide.
| Compound Name | N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-3-pyrrol-1-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 24625349 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-3-pyrrol-1-ylthiophene-2-carboxamide |
| SMILES | CC(C)NS(=O)(=O)Cc1ccc(CNC(=O)c2sccc2-n2cccc2)cc1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-15(2)22-28(25,26)14-17-7-5-16(6-8-17)13-21-20(24)19-18(9-12-27-19)23-10-3-4-11-23/h3-12,15,22H,13-14H2,1-2H3,(H,21,24) |
| InChIKey | DLAGXNIKOWKNPE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |