C16H19BrN2O4S — CID 39695571
5-bromo-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]furan-3-carboxamide (PubChem CID 39695571) has the molecular formula C16H19BrN2O4S and a molecular weight of 415.31 g/mol. Its IUPAC name is 5-bromo-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]furan-3-carboxamide.
| Compound Name | 5-bromo-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 39695571 |
| Molecular Formula | C16H19BrN2O4S |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 5-bromo-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]furan-3-carboxamide |
| SMILES | CC(C)NS(=O)(=O)Cc1ccc(CNC(=O)c2coc(Br)c2)cc1 |
| InChI | InChI=1S/C16H19BrN2O4S/c1-11(2)19-24(21,22)10-13-5-3-12(4-6-13)8-18-16(20)14-7-15(17)23-9-14/h3-7,9,11,19H,8,10H2,1-2H3,(H,18,20) |
| InChIKey | MGVNJBKTGQNHEU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |