C14H15N3OS — CID 74250077
2-cyclopropyl-4-methyl-N-(thiophen-3-ylmethyl)pyrimidine-5-carboxamide (PubChem CID 74250077) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-cyclopropyl-4-methyl-N-(thiophen-3-ylmethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-cyclopropyl-4-methyl-N-(thiophen-3-ylmethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 74250077 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-cyclopropyl-4-methyl-N-(thiophen-3-ylmethyl)pyrimidine-5-carboxamide |
| SMILES | Cc1nc(C2CC2)ncc1C(=O)NCc1ccsc1 |
| InChI | InChI=1S/C14H15N3OS/c1-9-12(7-15-13(17-9)11-2-3-11)14(18)16-6-10-4-5-19-8-10/h4-5,7-8,11H,2-3,6H2,1H3,(H,16,18) |
| InChIKey | JVVCTWCUVKQKFY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |