C20H27N5O3S — CID 95806068
N-benzyl-2-[(3S)-1-(dimethylsulfamoyl)piperidin-3-yl]-4-methylpyrimidine-5-carboxamide (PubChem CID 95806068) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is N-benzyl-2-[(3S)-1-(dimethylsulfamoyl)piperidin-3-yl]-4-methylpyrimidine-5-carboxamide.
| Compound Name | N-benzyl-2-[(3S)-1-(dimethylsulfamoyl)piperidin-3-yl]-4-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 95806068 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-benzyl-2-[(3S)-1-(dimethylsulfamoyl)piperidin-3-yl]-4-methylpyrimidine-5-carboxamide |
| SMILES | Cc1nc([C@H]2CCCN(S(=O)(=O)N(C)C)C2)ncc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H27N5O3S/c1-15-18(20(26)22-12-16-8-5-4-6-9-16)13-21-19(23-15)17-10-7-11-25(14-17)29(27,28)24(2)3/h4-6,8-9,13,17H,7,10-12,14H2,1-3H3,(H,22,26)/t17-/m0/s1 |
| InChIKey | LXVRCTPXGMFRAG-KRWDZBQOSA-N |
| XLogP | 1.70 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |