C22H29N5O3S — CID 110084678
4-methyl-N-phenyl-2-(1-piperidin-1-ylsulfonylpiperidin-3-yl)pyrimidine-5-carboxamide (PubChem CID 110084678) has the molecular formula C22H29N5O3S and a molecular weight of 443.57 g/mol. Its IUPAC name is 4-methyl-N-phenyl-2-(1-piperidin-1-ylsulfonylpiperidin-3-yl)pyrimidine-5-carboxamide.
| Compound Name | 4-methyl-N-phenyl-2-(1-piperidin-1-ylsulfonylpiperidin-3-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110084678 |
| Molecular Formula | C22H29N5O3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 4-methyl-N-phenyl-2-(1-piperidin-1-ylsulfonylpiperidin-3-yl)pyrimidine-5-carboxamide |
| SMILES | Cc1nc(C2CCCN(S(=O)(=O)N3CCCCC3)C2)ncc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H29N5O3S/c1-17-20(22(28)25-19-10-4-2-5-11-19)15-23-21(24-17)18-9-8-14-27(16-18)31(29,30)26-12-6-3-7-13-26/h2,4-5,10-11,15,18H,3,6-9,12-14,16H2,1H3,(H,25,28) |
| InChIKey | KMEVKMZUKBQIRB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |