C24H24N4O2 — CID 92639563
2-(1-benzoylpiperidin-4-yl)-4-methyl-N-phenylpyrimidine-5-carboxamide (PubChem CID 92639563) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-(1-benzoylpiperidin-4-yl)-4-methyl-N-phenylpyrimidine-5-carboxamide.
| Compound Name | 2-(1-benzoylpiperidin-4-yl)-4-methyl-N-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 92639563 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-(1-benzoylpiperidin-4-yl)-4-methyl-N-phenylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(C2CCN(C(=O)c3ccccc3)CC2)ncc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H24N4O2/c1-17-21(23(29)27-20-10-6-3-7-11-20)16-25-22(26-17)18-12-14-28(15-13-18)24(30)19-8-4-2-5-9-19/h2-11,16,18H,12-15H2,1H3,(H,27,29) |
| InChIKey | FTQXOWTVUBFFER-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |