C27H27N5O — CID 110084801
4-methyl-N-phenyl-2-[1-(quinolin-8-ylmethyl)piperidin-4-yl]pyrimidine-5-carboxamide (PubChem CID 110084801) has the molecular formula C27H27N5O and a molecular weight of 437.55 g/mol. Its IUPAC name is 4-methyl-N-phenyl-2-[1-(quinolin-8-ylmethyl)piperidin-4-yl]pyrimidine-5-carboxamide.
| Compound Name | 4-methyl-N-phenyl-2-[1-(quinolin-8-ylmethyl)piperidin-4-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110084801 |
| Molecular Formula | C27H27N5O |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 4-methyl-N-phenyl-2-[1-(quinolin-8-ylmethyl)piperidin-4-yl]pyrimidine-5-carboxamide |
| SMILES | Cc1nc(C2CCN(Cc3cccc4cccnc34)CC2)ncc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H27N5O/c1-19-24(27(33)31-23-10-3-2-4-11-23)17-29-26(30-19)21-12-15-32(16-13-21)18-22-8-5-7-20-9-6-14-28-25(20)22/h2-11,14,17,21H,12-13,15-16,18H2,1H3,(H,31,33) |
| InChIKey | YSGWZMWKHUEPEN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |