C23H21ClN4O2 — CID 110088672
2-(1-benzoylpyrrolidin-3-yl)-N-(4-chlorophenyl)-4-methylpyrimidine-5-carboxamide (PubChem CID 110088672) has the molecular formula C23H21ClN4O2 and a molecular weight of 420.90 g/mol. Its IUPAC name is 2-(1-benzoylpyrrolidin-3-yl)-N-(4-chlorophenyl)-4-methylpyrimidine-5-carboxamide.
| Compound Name | 2-(1-benzoylpyrrolidin-3-yl)-N-(4-chlorophenyl)-4-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110088672 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-(1-benzoylpyrrolidin-3-yl)-N-(4-chlorophenyl)-4-methylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(C2CCN(C(=O)c3ccccc3)C2)ncc1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21ClN4O2/c1-15-20(22(29)27-19-9-7-18(24)8-10-19)13-25-21(26-15)17-11-12-28(14-17)23(30)16-5-3-2-4-6-16/h2-10,13,17H,11-12,14H2,1H3,(H,27,29) |
| InChIKey | BJMSQFUGYVQUCQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |