C24H31NO5 — CID 1277920
2-(4-cyclohexylphenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 1277920) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is 2-(4-cyclohexylphenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(4-cyclohexylphenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 1277920 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 2-(4-cyclohexylphenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(CNC(=O)COc2ccc(C3CCCCC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H31NO5/c1-27-21-13-17(14-22(28-2)24(21)29-3)15-25-23(26)16-30-20-11-9-19(10-12-20)18-7-5-4-6-8-18/h9-14,18H,4-8,15-16H2,1-3H3,(H,25,26) |
| InChIKey | FWWLWBDGWKGENO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |