C24H31NO3 — CID 142212171
N-[(4-cyclooctylphenyl)methyl]-2-[4-(hydroxymethyl)phenoxy]acetamide (PubChem CID 142212171) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-[(4-cyclooctylphenyl)methyl]-2-[4-(hydroxymethyl)phenoxy]acetamide.
| Compound Name | N-[(4-cyclooctylphenyl)methyl]-2-[4-(hydroxymethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 142212171 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | N-[(4-cyclooctylphenyl)methyl]-2-[4-(hydroxymethyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(CO)cc1)NCc1ccc(C2CCCCCCC2)cc1 |
| InChI | InChI=1S/C24H31NO3/c26-17-20-10-14-23(15-11-20)28-18-24(27)25-16-19-8-12-22(13-9-19)21-6-4-2-1-3-5-7-21/h8-15,21,26H,1-7,16-18H2,(H,25,27) |
| InChIKey | LCKONHHQMWKDMA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |