C25H34N2O2 — CID 19630470
2-(4-cyclohexylphenoxy)-N-[4-(diethylaminomethyl)phenyl]acetamide (PubChem CID 19630470) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-(4-cyclohexylphenoxy)-N-[4-(diethylaminomethyl)phenyl]acetamide.
| Compound Name | 2-(4-cyclohexylphenoxy)-N-[4-(diethylaminomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19630470 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 2-(4-cyclohexylphenoxy)-N-[4-(diethylaminomethyl)phenyl]acetamide |
| SMILES | CCN(CC)Cc1ccc(NC(=O)COc2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H34N2O2/c1-3-27(4-2)18-20-10-14-23(15-11-20)26-25(28)19-29-24-16-12-22(13-17-24)21-8-6-5-7-9-21/h10-17,21H,3-9,18-19H2,1-2H3,(H,26,28) |
| InChIKey | LVYYXUCZWFFGMP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |